C23H30O6 — CID 68712606
methyl (2E,7Z)-6-hydroxy-5-[(4-methoxyphenyl)methoxy]-8-(4-methyl-3,6-dihydro-2H-pyran-2-yl)octa-2,7-dienoate (PubChem CID 68712606) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is methyl (2E,7Z)-6-hydroxy-5-[(4-methoxyphenyl)methoxy]-8-(4-methyl-3,6-dihydro-2H-pyran-2-yl)octa-2,7-dienoate.
| Compound Name | methyl (2E,7Z)-6-hydroxy-5-[(4-methoxyphenyl)methoxy]-8-(4-methyl-3,6-dihydro-2H-pyran-2-yl)octa-2,7-dienoate |
|---|---|
| PubChem CID | 68712606 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | methyl (2E,7Z)-6-hydroxy-5-[(4-methoxyphenyl)methoxy]-8-(4-methyl-3,6-dihydro-2H-pyran-2-yl)octa-2,7-dienoate |
| SMILES | COC(=O)/C=C/CC(OCc1ccc(OC)cc1)C(O)/C=C\C1CC(C)=CCO1 |
| InChI | InChI=1S/C23H30O6/c1-17-13-14-28-20(15-17)11-12-21(24)22(5-4-6-23(25)27-3)29-16-18-7-9-19(26-2)10-8-18/h4,6-13,20-22,24H,5,14-16H2,1-3H3/b6-4+,12-11- |
| InChIKey | HHDXMPUCODURRT-BZGFYIRUSA-N |
| XLogP | 3.35 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|