C27H36O6 — CID 59026952
[(2E,5S,7E)-5-[(4-methoxyphenyl)methoxy]-8-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]-6-oxoocta-2,7-dienyl] 2,2-dimethylpropanoate (PubChem CID 59026952) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is [(2E,5S,7E)-5-[(4-methoxyphenyl)methoxy]-8-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]-6-oxoocta-2,7-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2E,5S,7E)-5-[(4-methoxyphenyl)methoxy]-8-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]-6-oxoocta-2,7-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59026952 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | [(2E,5S,7E)-5-[(4-methoxyphenyl)methoxy]-8-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]-6-oxoocta-2,7-dienyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(CO[C@@H](C/C=C/COC(=O)C(C)(C)C)C(=O)/C=C/[C@@H]2CC(C)=CCO2)cc1 |
| InChI | InChI=1S/C27H36O6/c1-20-15-17-31-23(18-20)13-14-24(28)25(8-6-7-16-32-26(29)27(2,3)4)33-19-21-9-11-22(30-5)12-10-21/h6-7,9-15,23,25H,8,16-19H2,1-5H3/b7-6+,14-13+/t23-,25+/m1/s1 |
| InChIKey | KJXDYJSQKYEJQT-CYXHLPGTSA-N |
| XLogP | 4.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|