C29H44O6Si — CID 11237657
methyl (2E,5S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-8-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]octa-2,7-dienoate (PubChem CID 11237657) has the molecular formula C29H44O6Si and a molecular weight of 516.75 g/mol. Its IUPAC name is methyl (2E,5S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-8-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]octa-2,7-dienoate.
| Compound Name | methyl (2E,5S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-8-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]octa-2,7-dienoate |
|---|---|
| PubChem CID | 11237657 |
| Molecular Formula | C29H44O6Si |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | methyl (2E,5S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-8-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]octa-2,7-dienoate |
| SMILES | COC(=O)/C=C/C[C@H](OCc1ccc(OC)cc1)[C@H](/C=C/[C@@H]1CC(C)=CCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H44O6Si/c1-22-18-19-33-25(20-22)16-17-27(35-36(7,8)29(2,3)4)26(10-9-11-28(30)32-6)34-21-23-12-14-24(31-5)15-13-23/h9,11-18,25-27H,10,19-21H2,1-8H3/b11-9+,17-16+/t25-,26+,27+/m1/s1 |
| InChIKey | ZNFQJFOTNIFNHK-IXWDJDKNSA-N |
| XLogP | 6.38 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|