C28H44O5Si — CID 59026962
(1E,3S,4S,6E)-8-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-1-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]octa-1,6-dien-3-ol (PubChem CID 59026962) has the molecular formula C28H44O5Si and a molecular weight of 488.74 g/mol. Its IUPAC name is (1E,3S,4S,6E)-8-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-1-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]octa-1,6-dien-3-ol.
| Compound Name | (1E,3S,4S,6E)-8-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-1-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]octa-1,6-dien-3-ol |
|---|---|
| PubChem CID | 59026962 |
| Molecular Formula | C28H44O5Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | (1E,3S,4S,6E)-8-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-1-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]octa-1,6-dien-3-ol |
| SMILES | COc1ccc(CO[C@@H](C/C=C/CO[Si](C)(C)C(C)(C)C)[C@@H](O)/C=C/[C@@H]2CC(C)=CCO2)cc1 |
| InChI | InChI=1S/C28H44O5Si/c1-22-17-19-31-25(20-22)15-16-26(29)27(32-21-23-11-13-24(30-5)14-12-23)10-8-9-18-33-34(6,7)28(2,3)4/h8-9,11-17,25-27,29H,10,18-21H2,1-7H3/b9-8+,16-15+/t25-,26+,27+/m1/s1 |
| InChIKey | FYIPFOLPUSVCPC-FEUPEXDLSA-N |
| XLogP | 6.20 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|