C26H41NO6Si — CID 11306421
(4S)-3-[(E,2R)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]hex-4-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 11306421) has the molecular formula C26H41NO6Si and a molecular weight of 491.70 g/mol. Its IUPAC name is (4S)-3-[(E,2R)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]hex-4-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(E,2R)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]hex-4-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11306421 |
| Molecular Formula | C26H41NO6Si |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | (4S)-3-[(E,2R)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]hex-4-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(CO[C@H](C/C=C/CO[Si](C)(C)C(C)(C)C)C(=O)N2C(=O)OC[C@@H]2C(C)C)cc1 |
| InChI | InChI=1S/C26H41NO6Si/c1-19(2)22-18-32-25(29)27(22)24(28)23(31-17-20-12-14-21(30-6)15-13-20)11-9-10-16-33-34(7,8)26(3,4)5/h9-10,12-15,19,22-23H,11,16-18H2,1-8H3/b10-9+/t22-,23-/m1/s1 |
| InChIKey | FVQZOYPNKUMIBG-GZURJRJYSA-N |
| XLogP | 5.55 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|