C18H26O6S — CID 11257223
[(2R)-2-[(4R,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]pent-4-enyl] methanesulfonate (PubChem CID 11257223) has the molecular formula C18H26O6S and a molecular weight of 370.47 g/mol. Its IUPAC name is [(2R)-2-[(4R,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]pent-4-enyl] methanesulfonate.
| Compound Name | [(2R)-2-[(4R,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]pent-4-enyl] methanesulfonate |
|---|---|
| PubChem CID | 11257223 |
| Molecular Formula | C18H26O6S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [(2R)-2-[(4R,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]pent-4-enyl] methanesulfonate |
| SMILES | C=CC[C@H](COS(C)(=O)=O)[C@@H]1OC(c2ccc(OC)cc2)OC[C@@H]1C |
| InChI | InChI=1S/C18H26O6S/c1-5-6-15(12-23-25(4,19)20)17-13(2)11-22-18(24-17)14-7-9-16(21-3)10-8-14/h5,7-10,13,15,17-18H,1,6,11-12H2,2-4H3/t13-,15+,17+,18?/m0/s1 |
| InChIKey | QNJITELBFFABGN-SUZORAIBSA-N |
| XLogP | 2.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|