C18H28O5 — CID 11174734
(2R,3R,4S)-4-[(4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2-methylpentane-1,3-diol (PubChem CID 11174734) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (2R,3R,4S)-4-[(4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2-methylpentane-1,3-diol.
| Compound Name | (2R,3R,4S)-4-[(4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2-methylpentane-1,3-diol |
|---|---|
| PubChem CID | 11174734 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (2R,3R,4S)-4-[(4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2-methylpentane-1,3-diol |
| SMILES | COc1ccc(C2OC[C@@H](C)[C@H]([C@@H](C)[C@H](O)[C@H](C)CO)O2)cc1 |
| InChI | InChI=1S/C18H28O5/c1-11(9-19)16(20)13(3)17-12(2)10-22-18(23-17)14-5-7-15(21-4)8-6-14/h5-8,11-13,16-20H,9-10H2,1-4H3/t11-,12-,13+,16-,17-,18?/m1/s1 |
| InChIKey | XKDLCBPJGLDOEX-NSWLBBICSA-N |
| XLogP | 2.37 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |