C17H24O3 — CID 89375604
(4S,5S)-2-(4-methoxyphenyl)-5-methyl-4-[(2S)-pent-4-en-2-yl]-1,3-dioxane (PubChem CID 89375604) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (4S,5S)-2-(4-methoxyphenyl)-5-methyl-4-[(2S)-pent-4-en-2-yl]-1,3-dioxane.
| Compound Name | (4S,5S)-2-(4-methoxyphenyl)-5-methyl-4-[(2S)-pent-4-en-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 89375604 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (4S,5S)-2-(4-methoxyphenyl)-5-methyl-4-[(2S)-pent-4-en-2-yl]-1,3-dioxane |
| SMILES | C=CC[C@H](C)[C@@H]1OC(c2ccc(OC)cc2)OC[C@@H]1C |
| InChI | InChI=1S/C17H24O3/c1-5-6-12(2)16-13(3)11-19-17(20-16)14-7-9-15(18-4)10-8-14/h5,7-10,12-13,16-17H,1,6,11H2,2-4H3/t12-,13-,16-,17?/m0/s1 |
| InChIKey | PORYENJDXNOWDZ-OOZJWRCJSA-N |
| XLogP | 3.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|