About [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate
[3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate (PubChem CID 59283270) has the molecular formula C15H22O8S2
and a molecular weight of 394.47 g/mol. Its IUPAC name is [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate.
Molecular Properties
| Compound Name | [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate |
| PubChem CID | 59283270 |
| Molecular Formula | C15H22O8S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCC(COS(C)(=O)=O)C1COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C15H22O8S2/c1-24(16,17)22-10-14(11-23-25(2,18)19)13-8-20-15(21-9-13)12-6-4-3-5-7-12/h3-7,13-15H,8-11H2,1-2H3 |
| InChIKey | IXCLJTMXYPCFAU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate?
The IUPAC name of [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate (CID 59283270) is [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate.
What is the SMILES notation for [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate?
The canonical SMILES for [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate is CS(=O)(=O)OCC(COS(C)(=O)=O)C1COC(c2ccccc2)OC1.
What is the InChIKey of [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate?
The InChIKey is IXCLJTMXYPCFAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O8S2/c1-24(16,17)22-10-14(11-23-25(2,18)19)13-8-20-15(21-9-13)12-6-4-3-5-7-12/h3-7,13-15H,8-11H2,1-2H3.
What are the key properties of [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate?
[3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate has a molecular weight of 394.47 g/mol, XLogP of 0.92, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate is sourced from PubChem (CID 59283270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).