C15H22O8S2 — CID 59283270
[3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate (PubChem CID 59283270) has the molecular formula C15H22O8S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate.
| Compound Name | [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate |
|---|---|
| PubChem CID | 59283270 |
| Molecular Formula | C15H22O8S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [3-methylsulfonyloxy-2-(2-phenyl-1,3-dioxan-5-yl)propyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCC(COS(C)(=O)=O)C1COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C15H22O8S2/c1-24(16,17)22-10-14(11-23-25(2,18)19)13-8-20-15(21-9-13)12-6-4-3-5-7-12/h3-7,13-15H,8-11H2,1-2H3 |
| InChIKey | IXCLJTMXYPCFAU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|