C14H19N3O8S2 — CID 102078206
[(2S)-2-azido-2-[(2S,4R,5R)-5-methylsulfonyloxy-2-phenyl-1,3-dioxan-4-yl]ethyl] methanesulfonate (PubChem CID 102078206) has the molecular formula C14H19N3O8S2 and a molecular weight of 421.45 g/mol. Its IUPAC name is [(2S)-2-azido-2-[(2S,4R,5R)-5-methylsulfonyloxy-2-phenyl-1,3-dioxan-4-yl]ethyl] methanesulfonate.
| Compound Name | [(2S)-2-azido-2-[(2S,4R,5R)-5-methylsulfonyloxy-2-phenyl-1,3-dioxan-4-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 102078206 |
| Molecular Formula | C14H19N3O8S2 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | [(2S)-2-azido-2-[(2S,4R,5R)-5-methylsulfonyloxy-2-phenyl-1,3-dioxan-4-yl]ethyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H](N=[N+]=[N-])[C@H]1O[C@@H](c2ccccc2)OC[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C14H19N3O8S2/c1-26(18,19)23-8-11(16-17-15)13-12(25-27(2,20)21)9-22-14(24-13)10-6-4-3-5-7-10/h3-7,11-14H,8-9H2,1-2H3/t11-,12+,13+,14-/m0/s1 |
| InChIKey | HDYBDYFZWCOOFE-DGAVXFQQSA-N |
| XLogP | 1.10 |
| TPSA | 153.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|