C12H16O6S — CID 89332534
[(4S,5R)-4-ethyl-2-phenyl-1,3-dioxan-5-yl] hydrogen sulfate (PubChem CID 89332534) has the molecular formula C12H16O6S and a molecular weight of 288.32 g/mol. Its IUPAC name is [(4S,5R)-4-ethyl-2-phenyl-1,3-dioxan-5-yl] hydrogen sulfate.
| Compound Name | [(4S,5R)-4-ethyl-2-phenyl-1,3-dioxan-5-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 89332534 |
| Molecular Formula | C12H16O6S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | [(4S,5R)-4-ethyl-2-phenyl-1,3-dioxan-5-yl] hydrogen sulfate |
| SMILES | CC[C@@H]1OC(c2ccccc2)OC[C@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C12H16O6S/c1-2-10-11(18-19(13,14)15)8-16-12(17-10)9-6-4-3-5-7-9/h3-7,10-12H,2,8H2,1H3,(H,13,14,15)/t10-,11+,12?/m0/s1 |
| InChIKey | DWELVYBMAPDCEV-WIKAKEFZSA-N |
| XLogP | 1.70 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|