C37H40O9SSe — CID 134881901
[4-[[3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)selenolan-1-ium-1-yl]methyl]-2-phenyl-1,3-dioxan-5-yl] sulfate (PubChem CID 134881901) has the molecular formula C37H40O9SSe and a molecular weight of 739.75 g/mol. Its IUPAC name is [4-[[3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)selenolan-1-ium-1-yl]methyl]-2-phenyl-1,3-dioxan-5-yl] sulfate.
| Compound Name | [4-[[3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)selenolan-1-ium-1-yl]methyl]-2-phenyl-1,3-dioxan-5-yl] sulfate |
|---|---|
| PubChem CID | 134881901 |
| Molecular Formula | C37H40O9SSe |
| Molecular Weight | 739.75 g/mol |
| Exact Mass | 740.16 |
| IUPAC Name | [4-[[3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)selenolan-1-ium-1-yl]methyl]-2-phenyl-1,3-dioxan-5-yl] sulfate |
| SMILES | O=S(=O)([O-])OC1COC(c2ccccc2)OC1C[Se+]1CC(OCc2ccccc2)C(OCc2ccccc2)C1COCc1ccccc1 |
| InChI | InChI=1S/C37H40O9SSe/c38-47(39,40)46-32-24-44-37(31-19-11-4-12-20-31)45-33(32)26-48-27-34(42-22-29-15-7-2-8-16-29)36(43-23-30-17-9-3-10-18-30)35(48)25-41-21-28-13-5-1-6-14-28/h1-20,32-37H,21-27H2 |
| InChIKey | PHEAJUGKVIIZAI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.75 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|