C32H36O10S2 — CID 154711439
[(4S,5S)-4-[[(2R,3S)-3-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)methoxymethyl]-2,3-dihydrothiophen-1-ium-1-yl]methyl]-2-phenyl-1,3-dioxan-5-yl] sulfate (PubChem CID 154711439) has the molecular formula C32H36O10S2 and a molecular weight of 644.76 g/mol. Its IUPAC name is [(4S,5S)-4-[[(2R,3S)-3-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)methoxymethyl]-2,3-dihydrothiophen-1-ium-1-yl]methyl]-2-phenyl-1,3-dioxan-5-yl] sulfate.
| Compound Name | [(4S,5S)-4-[[(2R,3S)-3-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)methoxymethyl]-2,3-dihydrothiophen-1-ium-1-yl]methyl]-2-phenyl-1,3-dioxan-5-yl] sulfate |
|---|---|
| PubChem CID | 154711439 |
| Molecular Formula | C32H36O10S2 |
| Molecular Weight | 644.76 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | [(4S,5S)-4-[[(2R,3S)-3-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)methoxymethyl]-2,3-dihydrothiophen-1-ium-1-yl]methyl]-2-phenyl-1,3-dioxan-5-yl] sulfate |
| SMILES | COc1ccc(COC[C@@H]2[C@@H](OCc3ccc(OC)cc3)C=C[S+]2C[C@H]2OC(c3ccccc3)OC[C@@H]2OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C32H36O10S2/c1-36-26-12-8-23(9-13-26)18-38-21-31-28(39-19-24-10-14-27(37-2)15-11-24)16-17-43(31)22-30-29(42-44(33,34)35)20-40-32(41-30)25-6-4-3-5-7-25/h3-17,28-32H,18-22H2,1-2H3/t28-,29-,30+,31+,32?,43?/m0/s1 |
| InChIKey | YTYBLSRZQDQTSU-JENNBDFQSA-N |
| XLogP | 4.28 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.76 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|