C39H44O9S2 — CID 58747698
[(4S)-4-[[(2S,3S,4S,5R)-3-methyl-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thian-1-ium-1-yl]methyl]-2-phenyl-1,3-dioxan-5-yl] sulfate (PubChem CID 58747698) has the molecular formula C39H44O9S2 and a molecular weight of 720.91 g/mol. Its IUPAC name is [(4S)-4-[[(2S,3S,4S,5R)-3-methyl-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thian-1-ium-1-yl]methyl]-2-phenyl-1,3-dioxan-5-yl] sulfate.
| Compound Name | [(4S)-4-[[(2S,3S,4S,5R)-3-methyl-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thian-1-ium-1-yl]methyl]-2-phenyl-1,3-dioxan-5-yl] sulfate |
|---|---|
| PubChem CID | 58747698 |
| Molecular Formula | C39H44O9S2 |
| Molecular Weight | 720.91 g/mol |
| Exact Mass | 720.24 |
| IUPAC Name | [(4S)-4-[[(2S,3S,4S,5R)-3-methyl-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thian-1-ium-1-yl]methyl]-2-phenyl-1,3-dioxan-5-yl] sulfate |
| SMILES | C[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C[S+](C[C@H]2OC(c3ccccc3)OCC2OS(=O)(=O)[O-])[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C39H44O9S2/c1-29-37(26-43-22-30-14-6-2-7-15-30)49(27-35-34(48-50(40,41)42)25-46-39(47-35)33-20-12-5-13-21-33)28-36(44-23-31-16-8-3-9-17-31)38(29)45-24-32-18-10-4-11-19-32/h2-21,29,34-39H,22-28H2,1H3/t29-,34?,35-,36+,37-,38+,39?,49?/m1/s1 |
| InChIKey | DDZUQCPSENUEMQ-FTOGGIDJSA-N |
| XLogP | 5.97 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.91 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|