C36H43O13S2+ — CID 140834553
dimethyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanedioate (PubChem CID 140834553) has the molecular formula C36H43O13S2+ and a molecular weight of 747.86 g/mol. Its IUPAC name is dimethyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanedioate |
|---|---|
| PubChem CID | 140834553 |
| Molecular Formula | C36H43O13S2+ |
| Molecular Weight | 747.86 g/mol |
| Exact Mass | 747.21 |
| IUPAC Name | dimethyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C1OC[C@H](OS(=O)(=O)O)[C@@H](C[S+]2C[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2COCc2ccccc2)O1 |
| InChI | InChI=1S/C36H42O13S2/c1-42-34(37)32(35(38)43-2)36-47-21-28(49-51(39,40)41)29(48-36)23-50-24-30(45-19-26-14-8-4-9-15-26)33(46-20-27-16-10-5-11-17-27)31(50)22-44-18-25-12-6-3-7-13-25/h3-17,28-33,36H,18-24H2,1-2H3/p+1/t28-,29+,30+,31+,33-,36?,50?/m0/s1 |
| InChIKey | QJYUSJZUXXLXBD-JUTPZZHBSA-O |
| XLogP | 3.27 |
| TPSA | 162.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.86 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|