C53H56O11S2 — CID 11557030
[(2S,3S,4R,5R,6R)-2-[[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]methyl]-4,5,6-tris(phenylmethoxy)oxan-3-yl] sulfate (PubChem CID 11557030) has the molecular formula C53H56O11S2 and a molecular weight of 933.15 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-2-[[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]methyl]-4,5,6-tris(phenylmethoxy)oxan-3-yl] sulfate.
| Compound Name | [(2S,3S,4R,5R,6R)-2-[[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]methyl]-4,5,6-tris(phenylmethoxy)oxan-3-yl] sulfate |
|---|---|
| PubChem CID | 11557030 |
| Molecular Formula | C53H56O11S2 |
| Molecular Weight | 933.15 g/mol |
| Exact Mass | 932.33 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-2-[[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]methyl]-4,5,6-tris(phenylmethoxy)oxan-3-yl] sulfate |
| SMILES | O=S(=O)([O-])O[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)O[C@@H]1C[S+]1C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C53H56O11S2/c54-66(55,56)64-50-47(63-53(62-36-45-29-17-6-18-30-45)52(61-35-44-27-15-5-16-28-44)51(50)60-34-43-25-13-4-14-26-43)39-65-38-46(58-32-41-21-9-2-10-22-41)49(59-33-42-23-11-3-12-24-42)48(65)37-57-31-40-19-7-1-8-20-40/h1-30,46-53H,31-39H2/t46-,47-,48-,49+,50-,51+,52-,53-,65?/m1/s1 |
| InChIKey | STZIGTQZKKXIQQ-SHLBERJNSA-N |
| XLogP | 8.33 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.15 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|