C45H49O10S2+ — CID 59994421
[(4R,5R)-2-phenyl-4-[[(2R,3S,4R,5R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)thian-1-ium-1-yl]methyl]-1,3-dioxan-5-yl] hydrogen sulfate (PubChem CID 59994421) has the molecular formula C45H49O10S2+ and a molecular weight of 814.01 g/mol. Its IUPAC name is [(4R,5R)-2-phenyl-4-[[(2R,3S,4R,5R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)thian-1-ium-1-yl]methyl]-1,3-dioxan-5-yl] hydrogen sulfate.
| Compound Name | [(4R,5R)-2-phenyl-4-[[(2R,3S,4R,5R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)thian-1-ium-1-yl]methyl]-1,3-dioxan-5-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 59994421 |
| Molecular Formula | C45H49O10S2+ |
| Molecular Weight | 814.01 g/mol |
| Exact Mass | 813.28 |
| IUPAC Name | [(4R,5R)-2-phenyl-4-[[(2R,3S,4R,5R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)thian-1-ium-1-yl]methyl]-1,3-dioxan-5-yl] hydrogen sulfate |
| SMILES | O=S(=O)(O)O[C@@H]1COC(c2ccccc2)O[C@H]1C[S+]1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C45H48O10S2/c46-57(47,48)55-39-30-53-45(38-24-14-5-15-25-38)54-40(39)32-56-33-41(50-27-35-18-8-2-9-19-35)43(51-28-36-20-10-3-11-21-36)44(52-29-37-22-12-4-13-23-37)42(56)31-49-26-34-16-6-1-7-17-34/h1-25,39-45H,26-33H2/p+1/t39-,40+,41+,42-,43-,44-,45?,56?/m1/s1 |
| InChIKey | FLMCQGVIOOIIMD-ILHACMSDSA-O |
| XLogP | 7.26 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.01 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|