C37H41O9S2+ — CID 59994431
[(4R,5R)-2-phenyl-4-[[(3R,5S)-3,4,5-tris(phenylmethoxy)thian-1-ium-1-yl]methyl]-1,3-dioxan-5-yl] hydrogen sulfate (PubChem CID 59994431) has the molecular formula C37H41O9S2+ and a molecular weight of 693.86 g/mol. Its IUPAC name is [(4R,5R)-2-phenyl-4-[[(3R,5S)-3,4,5-tris(phenylmethoxy)thian-1-ium-1-yl]methyl]-1,3-dioxan-5-yl] hydrogen sulfate.
| Compound Name | [(4R,5R)-2-phenyl-4-[[(3R,5S)-3,4,5-tris(phenylmethoxy)thian-1-ium-1-yl]methyl]-1,3-dioxan-5-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 59994431 |
| Molecular Formula | C37H41O9S2+ |
| Molecular Weight | 693.86 g/mol |
| Exact Mass | 693.22 |
| IUPAC Name | [(4R,5R)-2-phenyl-4-[[(3R,5S)-3,4,5-tris(phenylmethoxy)thian-1-ium-1-yl]methyl]-1,3-dioxan-5-yl] hydrogen sulfate |
| SMILES | O=S(=O)(O)O[C@@H]1COC(c2ccccc2)O[C@H]1C[S+]1C[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C37H40O9S2/c38-48(39,40)46-32-24-44-37(31-19-11-4-12-20-31)45-33(32)25-47-26-34(41-21-28-13-5-1-6-14-28)36(43-23-30-17-9-3-10-18-30)35(27-47)42-22-29-15-7-2-8-16-29/h1-20,32-37H,21-27H2/p+1/t32-,33+,34-,35+,36?,37?,47?/m1/s1 |
| InChIKey | DQFLKJFCDZKPFS-CMVSQBLESA-O |
| XLogP | 5.68 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.86 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|