C21H23NO5 — CID 66686373
2-phenyl-8-phenylmethoxy-4,4a,5,7,8,8a-hexahydro-[1,3]dioxino[5,4-c]pyridine-6-carboxylic acid (PubChem CID 66686373) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-phenyl-8-phenylmethoxy-4,4a,5,7,8,8a-hexahydro-[1,3]dioxino[5,4-c]pyridine-6-carboxylic acid.
| Compound Name | 2-phenyl-8-phenylmethoxy-4,4a,5,7,8,8a-hexahydro-[1,3]dioxino[5,4-c]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 66686373 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-phenyl-8-phenylmethoxy-4,4a,5,7,8,8a-hexahydro-[1,3]dioxino[5,4-c]pyridine-6-carboxylic acid |
| SMILES | O=C(O)N1CC2COC(c3ccccc3)OC2C(OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H23NO5/c23-21(24)22-11-17-14-26-20(16-9-5-2-6-10-16)27-19(17)18(12-22)25-13-15-7-3-1-4-8-15/h1-10,17-20H,11-14H2,(H,23,24) |
| InChIKey | DLEJWVLGQVRHQJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |