C60H55O12S+ — CID 102434071
[(2S,3S,4S,5R)-4,5,6-tribenzoyloxy-2-[[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]methyl]oxan-3-yl] benzoate (PubChem CID 102434071) has the molecular formula C60H55O12S+ and a molecular weight of 1000.16 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-4,5,6-tribenzoyloxy-2-[[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]methyl]oxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4S,5R)-4,5,6-tribenzoyloxy-2-[[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]methyl]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 102434071 |
| Molecular Formula | C60H55O12S+ |
| Molecular Weight | 1000.16 g/mol |
| Exact Mass | 999.34 |
| IUPAC Name | [(2S,3S,4S,5R)-4,5,6-tribenzoyloxy-2-[[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]methyl]oxan-3-yl] benzoate |
| SMILES | O=C(OC1O[C@H](C[S+]2C[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2COCc2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C60H55O12S/c61-56(45-28-14-4-15-29-45)69-53-50(41-73-40-49(66-37-43-24-10-2-11-25-43)52(67-38-44-26-12-3-13-27-44)51(73)39-65-36-42-22-8-1-9-23-42)68-60(72-59(64)48-34-20-7-21-35-48)55(71-58(63)47-32-18-6-19-33-47)54(53)70-57(62)46-30-16-5-17-31-46/h1-35,49-55,60H,36-41H2/q+1/t49-,50-,51-,52+,53-,54+,55-,60?,73?/m1/s1 |
| InChIKey | ZTVNDEHIVQSHRS-QDHYLCKVSA-N |
| XLogP | 9.63 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.16 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|