C39H36N2O6 — CID 91699872
[(2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl] 4-phenyldiazenylbenzoate (PubChem CID 91699872) has the molecular formula C39H36N2O6 and a molecular weight of 628.73 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl] 4-phenyldiazenylbenzoate.
| Compound Name | [(2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl] 4-phenyldiazenylbenzoate |
|---|---|
| PubChem CID | 91699872 |
| Molecular Formula | C39H36N2O6 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | [(2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl] 4-phenyldiazenylbenzoate |
| SMILES | O=C(O[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1)c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C39H36N2O6/c42-38(32-21-23-34(24-22-32)41-40-33-19-11-4-12-20-33)47-39-37(45-27-31-17-9-3-10-18-31)36(44-26-30-15-7-2-8-16-30)35(46-39)28-43-25-29-13-5-1-6-14-29/h1-24,35-37,39H,25-28H2/b41-40+/t35-,36-,37-,39+/m1/s1 |
| InChIKey | CRGNNRBBHNCBCA-UPXPJRFPSA-N |
| XLogP | 8.37 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|