C17H21F3O8S — CID 58061976
[(4aR,7S,8R,8aR)-8-(2-methoxyethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate (PubChem CID 58061976) has the molecular formula C17H21F3O8S and a molecular weight of 442.41 g/mol. Its IUPAC name is [(4aR,7S,8R,8aR)-8-(2-methoxyethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate.
| Compound Name | [(4aR,7S,8R,8aR)-8-(2-methoxyethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58061976 |
| Molecular Formula | C17H21F3O8S |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | [(4aR,7S,8R,8aR)-8-(2-methoxyethoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate |
| SMILES | COCCO[C@@H]1[C@@H]2OC(c3ccccc3)OC[C@H]2OC[C@@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H21F3O8S/c1-23-7-8-24-14-13(28-29(21,22)17(18,19)20)10-25-12-9-26-16(27-15(12)14)11-5-3-2-4-6-11/h2-6,12-16H,7-10H2,1H3/t12-,13+,14+,15-,16?/m1/s1 |
| InChIKey | WQAPCDHKEZNLDY-RRMRAIHUSA-N |
| XLogP | 1.77 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|