C21H30O5 — CID 10970485
1-[(4R,5S,6R)-2-(4-methoxyphenyl)-5-methyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]butan-2-yl acetate (PubChem CID 10970485) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-[(4R,5S,6R)-2-(4-methoxyphenyl)-5-methyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]butan-2-yl acetate.
| Compound Name | 1-[(4R,5S,6R)-2-(4-methoxyphenyl)-5-methyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]butan-2-yl acetate |
|---|---|
| PubChem CID | 10970485 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-[(4R,5S,6R)-2-(4-methoxyphenyl)-5-methyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]butan-2-yl acetate |
| SMILES | C/C=C/[C@H]1OC(c2ccc(OC)cc2)O[C@H](CC(CC)OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C21H30O5/c1-6-8-19-14(3)20(13-17(7-2)24-15(4)22)26-21(25-19)16-9-11-18(23-5)12-10-16/h6,8-12,14,17,19-21H,7,13H2,1-5H3/b8-6+/t14-,17?,19-,20-,21?/m1/s1 |
| InChIKey | XOHFTKKZYBDUME-LUBNNIQWSA-N |
| XLogP | 4.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|