C12H19F2N3O3 — CID 90359957
[(2R)-1-(4-azido-5,6-difluoro-3-methyloxan-2-yl)butan-2-yl] acetate (PubChem CID 90359957) has the molecular formula C12H19F2N3O3 and a molecular weight of 291.30 g/mol. Its IUPAC name is [(2R)-1-(4-azido-5,6-difluoro-3-methyloxan-2-yl)butan-2-yl] acetate.
| Compound Name | [(2R)-1-(4-azido-5,6-difluoro-3-methyloxan-2-yl)butan-2-yl] acetate |
|---|---|
| PubChem CID | 90359957 |
| Molecular Formula | C12H19F2N3O3 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | [(2R)-1-(4-azido-5,6-difluoro-3-methyloxan-2-yl)butan-2-yl] acetate |
| SMILES | CC[C@H](CC1OC(F)C(F)C(N=[N+]=[N-])C1C)OC(C)=O |
| InChI | InChI=1S/C12H19F2N3O3/c1-4-8(19-7(3)18)5-9-6(2)11(16-17-15)10(13)12(14)20-9/h6,8-12H,4-5H2,1-3H3/t6?,8-,9?,10?,11?,12?/m1/s1 |
| InChIKey | ZJOYAWXAGPWMJT-TVAWKSBLSA-N |
| XLogP | 3.07 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|