C17H23FN12O6 — CID 167599081
[2-acetyloxy-4,6-diazido-3-[3-azido-6-(azidomethyl)-4-fluoro-5-methyloxan-2-yl]oxycyclohexyl] acetate (PubChem CID 167599081) has the molecular formula C17H23FN12O6 and a molecular weight of 510.45 g/mol. Its IUPAC name is [2-acetyloxy-4,6-diazido-3-[3-azido-6-(azidomethyl)-4-fluoro-5-methyloxan-2-yl]oxycyclohexyl] acetate.
| Compound Name | [2-acetyloxy-4,6-diazido-3-[3-azido-6-(azidomethyl)-4-fluoro-5-methyloxan-2-yl]oxycyclohexyl] acetate |
|---|---|
| PubChem CID | 167599081 |
| Molecular Formula | C17H23FN12O6 |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | [2-acetyloxy-4,6-diazido-3-[3-azido-6-(azidomethyl)-4-fluoro-5-methyloxan-2-yl]oxycyclohexyl] acetate |
| SMILES | CC(=O)OC1C(N=[N+]=[N-])CC(N=[N+]=[N-])C(OC2OC(CN=[N+]=[N-])C(C)C(F)C2N=[N+]=[N-])C1OC(C)=O |
| InChI | InChI=1S/C17H23FN12O6/c1-6-11(5-23-27-19)35-17(13(12(6)18)26-30-22)36-15-10(25-29-21)4-9(24-28-20)14(33-7(2)31)16(15)34-8(3)32/h6,9-17H,4-5H2,1-3H3 |
| InChIKey | PLLOLLIQELMVAF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 266.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|