C22H36FN9O7 — CID 168793311
[(1S,2S,3R,4S,6R)-4,6-diazido-3-[(2R,3S,4S,5R,6R)-6-(azidomethyl)-3,5-dibutoxy-4-fluorooxan-2-yl]oxy-2-hydroxycyclohexyl] acetate (PubChem CID 168793311) has the molecular formula C22H36FN9O7 and a molecular weight of 557.58 g/mol. Its IUPAC name is [(1S,2S,3R,4S,6R)-4,6-diazido-3-[(2R,3S,4S,5R,6R)-6-(azidomethyl)-3,5-dibutoxy-4-fluorooxan-2-yl]oxy-2-hydroxycyclohexyl] acetate.
| Compound Name | [(1S,2S,3R,4S,6R)-4,6-diazido-3-[(2R,3S,4S,5R,6R)-6-(azidomethyl)-3,5-dibutoxy-4-fluorooxan-2-yl]oxy-2-hydroxycyclohexyl] acetate |
|---|---|
| PubChem CID | 168793311 |
| Molecular Formula | C22H36FN9O7 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | [(1S,2S,3R,4S,6R)-4,6-diazido-3-[(2R,3S,4S,5R,6R)-6-(azidomethyl)-3,5-dibutoxy-4-fluorooxan-2-yl]oxy-2-hydroxycyclohexyl] acetate |
| SMILES | CCCCO[C@H]1[C@@H](O[C@H]2[C@H](O)[C@@H](OC(C)=O)[C@H](N=[N+]=[N-])C[C@@H]2N=[N+]=[N-])O[C@H](CN=[N+]=[N-])[C@@H](OCCCC)[C@@H]1F |
| InChI | InChI=1S/C22H36FN9O7/c1-4-6-8-35-20-15(11-27-30-24)38-22(21(16(20)23)36-9-7-5-2)39-19-14(29-32-26)10-13(28-31-25)18(17(19)34)37-12(3)33/h13-22,34H,4-11H2,1-3H3/t13-,14+,15-,16+,17-,18+,19-,20-,21-,22-/m1/s1 |
| InChIKey | APMHWVJKCPPHHF-YSQGBCSMSA-N |
| XLogP | 4.17 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|