C18H24N12O10 — CID 102321964
[(2R,3R,4R,5R,6R)-4-acetyloxy-6-[(1R,2S,3S,4R,5S,6S)-5-acetyloxy-2,4-diazido-3,6-dihydroxycyclohexyl]oxy-5-azido-2-(azidomethyl)oxan-3-yl] acetate (PubChem CID 102321964) has the molecular formula C18H24N12O10 and a molecular weight of 568.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-4-acetyloxy-6-[(1R,2S,3S,4R,5S,6S)-5-acetyloxy-2,4-diazido-3,6-dihydroxycyclohexyl]oxy-5-azido-2-(azidomethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-4-acetyloxy-6-[(1R,2S,3S,4R,5S,6S)-5-acetyloxy-2,4-diazido-3,6-dihydroxycyclohexyl]oxy-5-azido-2-(azidomethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 102321964 |
| Molecular Formula | C18H24N12O10 |
| Molecular Weight | 568.46 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-4-acetyloxy-6-[(1R,2S,3S,4R,5S,6S)-5-acetyloxy-2,4-diazido-3,6-dihydroxycyclohexyl]oxy-5-azido-2-(azidomethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CN=[N+]=[N-])[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2N=[N+]=[N-])[C@@H](N=[N+]=[N-])[C@H](O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C18H24N12O10/c1-5(31)36-14-8(4-23-27-19)39-18(11(26-30-22)17(14)38-7(3)33)40-16-10(25-29-21)12(34)9(24-28-20)15(13(16)35)37-6(2)32/h8-18,34-35H,4H2,1-3H3/t8-,9-,10+,11-,12-,13-,14-,15+,16-,17-,18-/m1/s1 |
| InChIKey | RVYIKNBLZXWFTA-QYGDTLLZSA-N |
| XLogP | 0.97 |
| TPSA | 332.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|