C20H30N6O11 — CID 167267436
[(2R,3R,4S)-4-acetyloxy-3-[(2R,4R,5R,6S)-4-acetyloxy-3-azido-6-(azidomethyl)-5-hydroxyoxan-2-yl]oxy-5-(3-hydroxypropyl)oxolan-2-yl]methyl acetate (PubChem CID 167267436) has the molecular formula C20H30N6O11 and a molecular weight of 530.49 g/mol. Its IUPAC name is [(2R,3R,4S)-4-acetyloxy-3-[(2R,4R,5R,6S)-4-acetyloxy-3-azido-6-(azidomethyl)-5-hydroxyoxan-2-yl]oxy-5-(3-hydroxypropyl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S)-4-acetyloxy-3-[(2R,4R,5R,6S)-4-acetyloxy-3-azido-6-(azidomethyl)-5-hydroxyoxan-2-yl]oxy-5-(3-hydroxypropyl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 167267436 |
| Molecular Formula | C20H30N6O11 |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | [(2R,3R,4S)-4-acetyloxy-3-[(2R,4R,5R,6S)-4-acetyloxy-3-azido-6-(azidomethyl)-5-hydroxyoxan-2-yl]oxy-5-(3-hydroxypropyl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(CCCO)[C@H](OC(C)=O)[C@@H]1O[C@H]1O[C@@H](CN=[N+]=[N-])[C@@H](O)[C@H](OC(C)=O)C1N=[N+]=[N-] |
| InChI | InChI=1S/C20H30N6O11/c1-9(28)32-8-14-18(17(33-10(2)29)12(35-14)5-4-6-27)37-20-15(24-26-22)19(34-11(3)30)16(31)13(36-20)7-23-25-21/h12-20,27,31H,4-8H2,1-3H3/t12?,13-,14+,15?,16+,17-,18+,19+,20+/m0/s1 |
| InChIKey | CTXRUUVHSYTAKM-XNYJAIFWSA-N |
| XLogP | 0.41 |
| TPSA | 244.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|