C17H24N6O10 — CID 164843882
[4-acetyloxy-3-[4-acetyloxy-3-azido-6-(azidomethyl)oxan-2-yl]oxy-5-hydroxyoxolan-2-yl]methyl acetate (PubChem CID 164843882) has the molecular formula C17H24N6O10 and a molecular weight of 472.41 g/mol. Its IUPAC name is [4-acetyloxy-3-[4-acetyloxy-3-azido-6-(azidomethyl)oxan-2-yl]oxy-5-hydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [4-acetyloxy-3-[4-acetyloxy-3-azido-6-(azidomethyl)oxan-2-yl]oxy-5-hydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 164843882 |
| Molecular Formula | C17H24N6O10 |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [4-acetyloxy-3-[4-acetyloxy-3-azido-6-(azidomethyl)oxan-2-yl]oxy-5-hydroxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(O)C(OC(C)=O)C1OC1OC(CN=[N+]=[N-])CC(OC(C)=O)C1N=[N+]=[N-] |
| InChI | InChI=1S/C17H24N6O10/c1-7(24)28-6-12-14(15(16(27)32-12)30-9(3)26)33-17-13(21-23-19)11(29-8(2)25)4-10(31-17)5-20-22-18/h10-17,27H,4-6H2,1-3H3 |
| InChIKey | BLQGWUDBBPXRFP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 224.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|