C26H36I3N3O17 — CID 159519402
[(3R,4S,6R)-4,5-diacetyloxy-3-azido-6-[(3R,4S,6S)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate;molecular iodine;hydroiodide (PubChem CID 159519402) has the molecular formula C26H36I3N3O17 and a molecular weight of 1043.29 g/mol. Its IUPAC name is [(3R,4S,6R)-4,5-diacetyloxy-3-azido-6-[(3R,4S,6S)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate;molecular iodine;hydroiodide.
| Compound Name | [(3R,4S,6R)-4,5-diacetyloxy-3-azido-6-[(3R,4S,6S)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate;molecular iodine;hydroiodide |
|---|---|
| PubChem CID | 159519402 |
| Molecular Formula | C26H36I3N3O17 |
| Molecular Weight | 1043.29 g/mol |
| Exact Mass | 1042.92 |
| IUPAC Name | [(3R,4S,6R)-4,5-diacetyloxy-3-azido-6-[(3R,4S,6S)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate;molecular iodine;hydroiodide |
| SMILES | CC(=O)OCC1O[C@H](O[C@@H]2C(COC(C)=O)O[C@@H](OC(C)=O)C(OC(C)=O)[C@H]2OC(C)=O)C(OC(C)=O)[C@@H](OC(C)=O)[C@@H]1N=[N+]=[N-].I.II |
| InChI | InChI=1S/C26H35N3O17.I2.HI/c1-10(30)37-8-17-19(28-29-27)21(39-12(3)32)23(41-14(5)34)26(44-17)46-20-18(9-38-11(2)31)45-25(43-16(7)36)24(42-15(6)35)22(20)40-13(4)33;1-2;/h17-26H,8-9H2,1-7H3;;1H/t17?,18?,19-,20-,21+,22+,23?,24?,25-,26-;;/m1../s1 |
| InChIKey | MJBKFHRCUYCHRE-XEKRKQBRSA-N |
| XLogP | 2.31 |
| TPSA | 260.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1043.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|