C12H18N3O11P — CID 11504450
[(2R,3S,4S,5R,6R)-4,5-diacetyloxy-2-(azidomethyl)-6-phosphonooxyoxan-3-yl] acetate (PubChem CID 11504450) has the molecular formula C12H18N3O11P and a molecular weight of 411.26 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4,5-diacetyloxy-2-(azidomethyl)-6-phosphonooxyoxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-4,5-diacetyloxy-2-(azidomethyl)-6-phosphonooxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 11504450 |
| Molecular Formula | C12H18N3O11P |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4,5-diacetyloxy-2-(azidomethyl)-6-phosphonooxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)[C@@H](CN=[N+]=[N-])O[C@H](OP(=O)(O)O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H18N3O11P/c1-5(16)22-9-8(4-14-15-13)25-12(26-27(19,20)21)11(24-7(3)18)10(9)23-6(2)17/h8-12H,4H2,1-3H3,(H2,19,20,21)/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | PSQGKEIGOOCKNX-YBXAARCKSA-N |
| XLogP | -0.07 |
| TPSA | 203.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|