C26H51N2O13P — CID 155091222
bis(N,N-diethylethanamine);[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-phosphonooxyoxan-2-yl]methyl acetate (PubChem CID 155091222) has the molecular formula C26H51N2O13P and a molecular weight of 630.67 g/mol. Its IUPAC name is bis(N,N-diethylethanamine);[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-phosphonooxyoxan-2-yl]methyl acetate.
| Compound Name | bis(N,N-diethylethanamine);[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-phosphonooxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155091222 |
| Molecular Formula | C26H51N2O13P |
| Molecular Weight | 630.67 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | bis(N,N-diethylethanamine);[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-phosphonooxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OP(=O)(O)O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O.CCN(CC)CC.CCN(CC)CC |
| InChI | InChI=1S/C14H21O13P.2C6H15N/c1-6(15)22-5-10-11(23-7(2)16)12(24-8(3)17)13(25-9(4)18)14(26-10)27-28(19,20)21;2*1-4-7(5-2)6-3/h10-14H,5H2,1-4H3,(H2,19,20,21);2*4-6H2,1-3H3/t10-,11-,12+,13+,14+;;/m1../s1 |
| InChIKey | UVIFYKPXGYWADD-QAZNCASESA-N |
| XLogP | 1.88 |
| TPSA | 187.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.67 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|