C20H35NO12S — CID 11670744
N,N-diethylethanamine;(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-sulfonic acid (PubChem CID 11670744) has the molecular formula C20H35NO12S and a molecular weight of 513.56 g/mol. Its IUPAC name is N,N-diethylethanamine;(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-sulfonic acid.
| Compound Name | N,N-diethylethanamine;(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-sulfonic acid |
|---|---|
| PubChem CID | 11670744 |
| Molecular Formula | C20H35NO12S |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | N,N-diethylethanamine;(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-sulfonic acid |
| SMILES | CC(=O)OC[C@H]1O[C@@H](S(=O)(=O)O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O.CCN(CC)CC |
| InChI | InChI=1S/C14H20O12S.C6H15N/c1-6(15)22-5-10-11(23-7(2)16)12(24-8(3)17)13(25-9(4)18)14(26-10)27(19,20)21;1-4-7(5-2)6-3/h10-14H,5H2,1-4H3,(H,19,20,21);4-6H2,1-3H3/t10-,11-,12+,13-,14+;/m1./s1 |
| InChIKey | OQGAKBSICAOVEE-SXQUUHMTSA-N |
| XLogP | 0.31 |
| TPSA | 172.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|