C10H14N6O5 — CID 101051062
[(1S,3R,4S,6R)-3-acetyloxy-4,6-diazido-2-hydroxycyclohexyl] acetate (PubChem CID 101051062) has the molecular formula C10H14N6O5 and a molecular weight of 298.26 g/mol. Its IUPAC name is [(1S,3R,4S,6R)-3-acetyloxy-4,6-diazido-2-hydroxycyclohexyl] acetate.
| Compound Name | [(1S,3R,4S,6R)-3-acetyloxy-4,6-diazido-2-hydroxycyclohexyl] acetate |
|---|---|
| PubChem CID | 101051062 |
| Molecular Formula | C10H14N6O5 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | [(1S,3R,4S,6R)-3-acetyloxy-4,6-diazido-2-hydroxycyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1C(O)[C@H](OC(C)=O)[C@@H](N=[N+]=[N-])C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C10H14N6O5/c1-4(17)20-9-6(13-15-11)3-7(14-16-12)10(8(9)19)21-5(2)18/h6-10,19H,3H2,1-2H3/t6-,7+,8?,9+,10- |
| InChIKey | CGRDDYVJGZMFAP-KOIWVBIESA-N |
| XLogP | 0.97 |
| TPSA | 170.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|