C9H15N3O3 — CID 167266541
[(1S,4S,6S)-2-azido-6-hydroxy-4-methylcyclohexyl] acetate (PubChem CID 167266541) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is [(1S,4S,6S)-2-azido-6-hydroxy-4-methylcyclohexyl] acetate.
| Compound Name | [(1S,4S,6S)-2-azido-6-hydroxy-4-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 167266541 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | [(1S,4S,6S)-2-azido-6-hydroxy-4-methylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1C(N=[N+]=[N-])C[C@H](C)C[C@@H]1O |
| InChI | InChI=1S/C9H15N3O3/c1-5-3-7(11-12-10)9(8(14)4-5)15-6(2)13/h5,7-9,14H,3-4H2,1-2H3/t5-,7?,8-,9-/m0/s1 |
| InChIKey | ZRTRPSOWFZCSOS-KOOFMTINSA-N |
| XLogP | 1.39 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|