C9H14N6O3 — CID 167589067
[(1R,2R,3S,5R,6S)-3,5-diazido-2-hydroxy-6-methylcyclohexyl] acetate (PubChem CID 167589067) has the molecular formula C9H14N6O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is [(1R,2R,3S,5R,6S)-3,5-diazido-2-hydroxy-6-methylcyclohexyl] acetate.
| Compound Name | [(1R,2R,3S,5R,6S)-3,5-diazido-2-hydroxy-6-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 167589067 |
| Molecular Formula | C9H14N6O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | [(1R,2R,3S,5R,6S)-3,5-diazido-2-hydroxy-6-methylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](C)[C@H](N=[N+]=[N-])C[C@H](N=[N+]=[N-])[C@H]1O |
| InChI | InChI=1S/C9H14N6O3/c1-4-6(12-14-10)3-7(13-15-11)8(17)9(4)18-5(2)16/h4,6-9,17H,3H2,1-2H3/t4-,6+,7-,8+,9+/m0/s1 |
| InChIKey | IEPIYPLSNJTBNZ-VEMNEOHVSA-N |
| XLogP | 1.68 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|