C10H17N3O3 — CID 121403642
(2-azido-4,5,6-trimethyloxan-3-yl) acetate (PubChem CID 121403642) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is (2-azido-4,5,6-trimethyloxan-3-yl) acetate.
| Compound Name | (2-azido-4,5,6-trimethyloxan-3-yl) acetate |
|---|---|
| PubChem CID | 121403642 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (2-azido-4,5,6-trimethyloxan-3-yl) acetate |
| SMILES | CC(=O)OC1C(N=[N+]=[N-])OC(C)C(C)C1C |
| InChI | InChI=1S/C10H17N3O3/c1-5-6(2)9(16-8(4)14)10(12-13-11)15-7(5)3/h5-7,9-10H,1-4H3 |
| InChIKey | OGTMZZKMXKGXMJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|