C14H19N3O9 — CID 86731914
2-[(2R,3R,4S,5S,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-azidooxan-3-yl]acetic acid (PubChem CID 86731914) has the molecular formula C14H19N3O9 and a molecular weight of 373.32 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5S,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-azidooxan-3-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4S,5S,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-azidooxan-3-yl]acetic acid |
|---|---|
| PubChem CID | 86731914 |
| Molecular Formula | C14H19N3O9 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-[(2R,3R,4S,5S,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-azidooxan-3-yl]acetic acid |
| SMILES | CC(=O)OC[C@@H]1O[C@H](N=[N+]=[N-])[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1CC(=O)O |
| InChI | InChI=1S/C14H19N3O9/c1-6(18)23-5-10-9(4-11(21)22)12(24-7(2)19)13(25-8(3)20)14(26-10)16-17-15/h9-10,12-14H,4-5H2,1-3H3,(H,21,22)/t9-,10+,12+,13+,14+/m1/s1 |
| InChIKey | YVEBTPYYVOWGEM-ZZEGJQGJSA-N |
| XLogP | 0.54 |
| TPSA | 174.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|