C26H35BrN6O16 — CID 175748068
2-[(3R,4S,5R,6R)-6-(acetyloxymethyl)-4-azido-2,5-bis(carboxymethyl)oxan-3-yl]acetic acid;[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-bromooxan-2-yl]methyl acetate (PubChem CID 175748068) has the molecular formula C26H35BrN6O16 and a molecular weight of 767.50 g/mol. Its IUPAC name is 2-[(3R,4S,5R,6R)-6-(acetyloxymethyl)-4-azido-2,5-bis(carboxymethyl)oxan-3-yl]acetic acid;[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-bromooxan-2-yl]methyl acetate.
| Compound Name | 2-[(3R,4S,5R,6R)-6-(acetyloxymethyl)-4-azido-2,5-bis(carboxymethyl)oxan-3-yl]acetic acid;[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-bromooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 175748068 |
| Molecular Formula | C26H35BrN6O16 |
| Molecular Weight | 767.50 g/mol |
| Exact Mass | 766.13 |
| IUPAC Name | 2-[(3R,4S,5R,6R)-6-(acetyloxymethyl)-4-azido-2,5-bis(carboxymethyl)oxan-3-yl]acetic acid;[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-bromooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1OC(CC(=O)O)[C@H](CC(=O)O)[C@H](N=[N+]=[N-])[C@H]1CC(=O)O.CC(=O)OC[C@H]1O[C@H](Br)[C@H](OC(C)=O)[C@@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H19N3O9.C12H16BrN3O7/c1-6(18)25-5-10-8(3-12(21)22)14(16-17-15)7(2-11(19)20)9(26-10)4-13(23)24;1-5(17)20-4-8-10(21-6(2)18)9(15-16-14)11(12(13)23-8)22-7(3)19/h7-10,14H,2-5H2,1H3,(H,19,20)(H,21,22)(H,23,24);8-12H,4H2,1-3H3/t7-,8-,9?,10-,14-;8-,9+,10+,11-,12+/m01/s1 |
| InChIKey | GZSFNBSZKVMNMD-TWISZLSLSA-N |
| XLogP | 1.86 |
| TPSA | 333.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|