C12H17N3O7 — CID 133118759
[(3S,6R)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate (PubChem CID 133118759) has the molecular formula C12H17N3O7 and a molecular weight of 315.28 g/mol. Its IUPAC name is [(3S,6R)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate.
| Compound Name | [(3S,6R)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 133118759 |
| Molecular Formula | C12H17N3O7 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | [(3S,6R)-4,5-diacetyloxy-6-azido-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)[C@H](N=[N+]=[N-])OC(C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H17N3O7/c1-5-9(20-6(2)16)10(21-7(3)17)11(22-8(4)18)12(19-5)14-15-13/h5,9-12H,1-4H3/t5?,9-,10?,11?,12+/m0/s1 |
| InChIKey | MKZJGETUNXHZRX-ZVPKIOOISA-N |
| XLogP | 0.84 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|