C15H22N4O8 — CID 102152677
[(2R,3R,4S,5S,6S)-3,5-diacetyloxy-2-azido-6-(propan-2-ylcarbamoyl)oxan-4-yl] acetate (PubChem CID 102152677) has the molecular formula C15H22N4O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,5-diacetyloxy-2-azido-6-(propan-2-ylcarbamoyl)oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,5-diacetyloxy-2-azido-6-(propan-2-ylcarbamoyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 102152677 |
| Molecular Formula | C15H22N4O8 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,5-diacetyloxy-2-azido-6-(propan-2-ylcarbamoyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](N=[N+]=[N-])O[C@H](C(=O)NC(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H22N4O8/c1-6(2)17-14(23)12-10(24-7(3)20)11(25-8(4)21)13(26-9(5)22)15(27-12)18-19-16/h6,10-13,15H,1-5H3,(H,17,23)/t10-,11-,12-,13+,15+/m0/s1 |
| InChIKey | XYZPOSXXPNVNCC-XOBFJNJYSA-N |
| XLogP | 0.34 |
| TPSA | 165.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|