C20H28N4O12 — CID 58654887
[(3R,4S,6R)-3,5-diacetyloxy-2-[[(6R,6aR)-4-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylcarbamoyl]-6-azidooxan-4-yl] acetate (PubChem CID 58654887) has the molecular formula C20H28N4O12 and a molecular weight of 516.46 g/mol. Its IUPAC name is [(3R,4S,6R)-3,5-diacetyloxy-2-[[(6R,6aR)-4-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylcarbamoyl]-6-azidooxan-4-yl] acetate.
| Compound Name | [(3R,4S,6R)-3,5-diacetyloxy-2-[[(6R,6aR)-4-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylcarbamoyl]-6-azidooxan-4-yl] acetate |
|---|---|
| PubChem CID | 58654887 |
| Molecular Formula | C20H28N4O12 |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | [(3R,4S,6R)-3,5-diacetyloxy-2-[[(6R,6aR)-4-hydroxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylcarbamoyl]-6-azidooxan-4-yl] acetate |
| SMILES | CC(=O)OC1[C@H](N=[N+]=[N-])OC(C(=O)NC[C@H]2OC(O)C3OC(C)(C)O[C@@H]32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H28N4O12/c1-7(25)30-12-13(31-8(2)26)15(32-9(3)27)18(23-24-21)34-14(12)17(28)22-6-10-11-16(19(29)33-10)36-20(4,5)35-11/h10-16,18-19,29H,6H2,1-5H3,(H,22,28)/t10-,11-,12-,13+,14?,15?,16?,18-,19?/m1/s1 |
| InChIKey | SHCYJQSLJOKJCJ-NIYDLSDLSA-N |
| XLogP | -0.83 |
| TPSA | 213.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|