C11H15N3O7 — CID 11702173
[(3S,4S,5R,6R)-4,5-diacetyloxy-6-azidooxan-3-yl] acetate (PubChem CID 11702173) has the molecular formula C11H15N3O7 and a molecular weight of 301.26 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-4,5-diacetyloxy-6-azidooxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-azidooxan-3-yl] acetate |
|---|---|
| PubChem CID | 11702173 |
| Molecular Formula | C11H15N3O7 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-azidooxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](N=[N+]=[N-])OC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C11H15N3O7/c1-5(15)19-8-4-18-11(13-14-12)10(21-7(3)17)9(8)20-6(2)16/h8-11H,4H2,1-3H3/t8-,9-,10+,11+/m0/s1 |
| InChIKey | LMAJKBXVWKPVDF-UKKRHICBSA-N |
| XLogP | 0.45 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|