C13H20N4O4 — CID 161200542
[(1S,6R,7R,8S,8aR)-8-acetyloxy-6-azido-7-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate (PubChem CID 161200542) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is [(1S,6R,7R,8S,8aR)-8-acetyloxy-6-azido-7-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate.
| Compound Name | [(1S,6R,7R,8S,8aR)-8-acetyloxy-6-azido-7-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate |
|---|---|
| PubChem CID | 161200542 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [(1S,6R,7R,8S,8aR)-8-acetyloxy-6-azido-7-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](C)[C@@H](N=[N+]=[N-])CN2CC[C@H](OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C13H20N4O4/c1-7-10(15-16-14)6-17-5-4-11(20-8(2)18)12(17)13(7)21-9(3)19/h7,10-13H,4-6H2,1-3H3/t7-,10+,11+,12-,13+/m1/s1 |
| InChIKey | UUXNWKLRLAEHKB-RECBEJSDSA-N |
| XLogP | 1.25 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|