C10H18N2O2 — CID 162863042
[(1R,8S,8aS)-8-amino-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate (PubChem CID 162863042) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is [(1R,8S,8aS)-8-amino-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate.
| Compound Name | [(1R,8S,8aS)-8-amino-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate |
|---|---|
| PubChem CID | 162863042 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | [(1R,8S,8aS)-8-amino-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCN2CCC[C@H](N)[C@@H]12 |
| InChI | InChI=1S/C10H18N2O2/c1-7(13)14-9-4-6-12-5-2-3-8(11)10(9)12/h8-10H,2-6,11H2,1H3/t8-,9+,10-/m0/s1 |
| InChIKey | DKSUKPLTJHGMRT-AEJSXWLSSA-N |
| XLogP | 0.11 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |