C10H15N3O7 — CID 102586452
[(1S,2R,3S,4S,5S,6R)-2-acetyloxy-5-azido-3,4,6-trihydroxycyclohexyl] acetate (PubChem CID 102586452) has the molecular formula C10H15N3O7 and a molecular weight of 289.24 g/mol. Its IUPAC name is [(1S,2R,3S,4S,5S,6R)-2-acetyloxy-5-azido-3,4,6-trihydroxycyclohexyl] acetate.
| Compound Name | [(1S,2R,3S,4S,5S,6R)-2-acetyloxy-5-azido-3,4,6-trihydroxycyclohexyl] acetate |
|---|---|
| PubChem CID | 102586452 |
| Molecular Formula | C10H15N3O7 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | [(1S,2R,3S,4S,5S,6R)-2-acetyloxy-5-azido-3,4,6-trihydroxycyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@@H](O)[C@H](N=[N+]=[N-])[C@@H](O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C10H15N3O7/c1-3(14)19-9-7(17)5(12-13-11)6(16)8(18)10(9)20-4(2)15/h5-10,16-18H,1-2H3/t5-,6-,7+,8-,9-,10+/m0/s1 |
| InChIKey | WETCVUUBTNRFFF-OAJPDZBQSA-N |
| XLogP | -1.38 |
| TPSA | 162.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|