C21H36N6O6 — CID 158144644
[(2S,4R,5S)-6-azido-5-[(2R,4S,5S)-3-azido-4,5-dimethyl-6-propan-2-yloxan-2-yl]oxy-2-butyl-4-hydroxyoxan-3-yl] acetate (PubChem CID 158144644) has the molecular formula C21H36N6O6 and a molecular weight of 468.56 g/mol. Its IUPAC name is [(2S,4R,5S)-6-azido-5-[(2R,4S,5S)-3-azido-4,5-dimethyl-6-propan-2-yloxan-2-yl]oxy-2-butyl-4-hydroxyoxan-3-yl] acetate.
| Compound Name | [(2S,4R,5S)-6-azido-5-[(2R,4S,5S)-3-azido-4,5-dimethyl-6-propan-2-yloxan-2-yl]oxy-2-butyl-4-hydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 158144644 |
| Molecular Formula | C21H36N6O6 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | [(2S,4R,5S)-6-azido-5-[(2R,4S,5S)-3-azido-4,5-dimethyl-6-propan-2-yloxan-2-yl]oxy-2-butyl-4-hydroxyoxan-3-yl] acetate |
| SMILES | CCCC[C@@H]1OC(N=[N+]=[N-])[C@@H](O[C@H]2OC(C(C)C)[C@@H](C)[C@H](C)C2N=[N+]=[N-])[C@H](O)C1OC(C)=O |
| InChI | InChI=1S/C21H36N6O6/c1-7-8-9-14-18(30-13(6)28)16(29)19(20(31-14)25-27-23)33-21-15(24-26-22)11(4)12(5)17(32-21)10(2)3/h10-12,14-21,29H,7-9H2,1-6H3/t11-,12-,14-,15?,16+,17?,18?,19-,20?,21+/m0/s1 |
| InChIKey | NXELLSUMTMJVCJ-QAAUWNJHSA-N |
| XLogP | 4.22 |
| TPSA | 171.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|