C18H30N6O5S — CID 118933636
[(2R,4S,5S)-5-azido-2-[(2R,4S,5S)-5-azido-2-ethylsulfanyl-4,6-dimethyloxan-3-yl]oxy-4,6-dimethyloxan-3-yl] acetate (PubChem CID 118933636) has the molecular formula C18H30N6O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is [(2R,4S,5S)-5-azido-2-[(2R,4S,5S)-5-azido-2-ethylsulfanyl-4,6-dimethyloxan-3-yl]oxy-4,6-dimethyloxan-3-yl] acetate.
| Compound Name | [(2R,4S,5S)-5-azido-2-[(2R,4S,5S)-5-azido-2-ethylsulfanyl-4,6-dimethyloxan-3-yl]oxy-4,6-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 118933636 |
| Molecular Formula | C18H30N6O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [(2R,4S,5S)-5-azido-2-[(2R,4S,5S)-5-azido-2-ethylsulfanyl-4,6-dimethyloxan-3-yl]oxy-4,6-dimethyloxan-3-yl] acetate |
| SMILES | CCS[C@H]1OC(C)[C@@H](N=[N+]=[N-])[C@H](C)C1O[C@H]1OC(C)[C@@H](N=[N+]=[N-])[C@H](C)C1OC(C)=O |
| InChI | InChI=1S/C18H30N6O5S/c1-7-30-18-16(9(3)14(22-24-20)11(5)27-18)29-17-15(28-12(6)25)8(2)13(21-23-19)10(4)26-17/h8-11,13-18H,7H2,1-6H3/t8-,9-,10?,11?,13-,14-,15?,16?,17+,18+/m0/s1 |
| InChIKey | RNVQBZJAQBTWRC-QVMZFXOPSA-N |
| XLogP | 4.18 |
| TPSA | 151.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|