C8H16N4O2S — CID 132527253
(2S,3R,4R,5R,6R)-3-amino-5-azido-2-ethylsulfanyl-6-methyloxan-4-ol (PubChem CID 132527253) has the molecular formula C8H16N4O2S and a molecular weight of 232.31 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-3-amino-5-azido-2-ethylsulfanyl-6-methyloxan-4-ol.
| Compound Name | (2S,3R,4R,5R,6R)-3-amino-5-azido-2-ethylsulfanyl-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 132527253 |
| Molecular Formula | C8H16N4O2S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (2S,3R,4R,5R,6R)-3-amino-5-azido-2-ethylsulfanyl-6-methyloxan-4-ol |
| SMILES | CCS[C@@H]1O[C@H](C)[C@H](N=[N+]=[N-])[C@H](O)[C@H]1N |
| InChI | InChI=1S/C8H16N4O2S/c1-3-15-8-5(9)7(13)6(11-12-10)4(2)14-8/h4-8,13H,3,9H2,1-2H3/t4-,5-,6+,7-,8+/m1/s1 |
| InChIKey | KZEOLVALMPEDCA-CBQIKETKSA-N |
| XLogP | 0.85 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|