C9H17N3O — CID 161426107
(4S,5S)-3-azido-2,4,5,6-tetramethyloxane (PubChem CID 161426107) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is (4S,5S)-3-azido-2,4,5,6-tetramethyloxane.
| Compound Name | (4S,5S)-3-azido-2,4,5,6-tetramethyloxane |
|---|---|
| PubChem CID | 161426107 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (4S,5S)-3-azido-2,4,5,6-tetramethyloxane |
| SMILES | CC1OC(C)[C@@H](C)[C@H](C)C1N=[N+]=[N-] |
| InChI | InChI=1S/C9H17N3O/c1-5-6(2)9(11-12-10)8(4)13-7(5)3/h5-9H,1-4H3/t5-,6-,7?,8?,9?/m0/s1 |
| InChIKey | VXJMKPXANSSJKC-MZLQIHHMSA-N |
| XLogP | 2.74 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|